C22H28N2O7 — CID 69423559
tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]carbamate (PubChem CID 69423559) has the molecular formula C22H28N2O7 and a molecular weight of 432.47 g/mol. Its IUPAC name is tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 69423559 |
| Molecular Formula | C22H28N2O7 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]carbamate |
| SMILES | COc1ccc(CN(CC(O)c2ccc([N+](=O)[O-])cc2)C(=O)OC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C22H28N2O7/c1-22(2,3)31-21(26)23(13-16-8-11-18(29-4)12-20(16)30-5)14-19(25)15-6-9-17(10-7-15)24(27)28/h6-12,19,25H,13-14H2,1-5H3 |
| InChIKey | OLEOODVPCZRWBX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|