C21H26N2O5 — CID 141402586
tert-butyl N-(2-hydroxy-2-phenylethyl)-N-[2-(2-nitrophenyl)ethyl]carbamate (PubChem CID 141402586) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is tert-butyl N-(2-hydroxy-2-phenylethyl)-N-[2-(2-nitrophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-(2-hydroxy-2-phenylethyl)-N-[2-(2-nitrophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 141402586 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | tert-butyl N-(2-hydroxy-2-phenylethyl)-N-[2-(2-nitrophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1ccccc1[N+](=O)[O-])CC(O)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O5/c1-21(2,3)28-20(25)22(15-19(24)17-10-5-4-6-11-17)14-13-16-9-7-8-12-18(16)23(26)27/h4-12,19,24H,13-15H2,1-3H3 |
| InChIKey | AVJZTOJWTQUWGT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|