C35H34ClN3O7 — CID 175609491
tert-butyl N-[2-[4-[(2-benzoyl-5-nitrobenzoyl)amino]phenyl]ethyl]-N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate (PubChem CID 175609491) has the molecular formula C35H34ClN3O7 and a molecular weight of 644.12 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(2-benzoyl-5-nitrobenzoyl)amino]phenyl]ethyl]-N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(2-benzoyl-5-nitrobenzoyl)amino]phenyl]ethyl]-N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 175609491 |
| Molecular Formula | C35H34ClN3O7 |
| Molecular Weight | 644.12 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | tert-butyl N-[2-[4-[(2-benzoyl-5-nitrobenzoyl)amino]phenyl]ethyl]-N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1ccc(NC(=O)c2cc([N+](=O)[O-])ccc2C(=O)c2ccccc2)cc1)C[C@H](O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C35H34ClN3O7/c1-35(2,3)46-34(43)38(22-31(40)25-10-7-11-26(36)20-25)19-18-23-12-14-27(15-13-23)37-33(42)30-21-28(39(44)45)16-17-29(30)32(41)24-8-5-4-6-9-24/h4-17,20-21,31,40H,18-19,22H2,1-3H3,(H,37,42)/t31-/m0/s1 |
| InChIKey | IDTMFCKFIZJQBT-HKBQPEDESA-N |
| XLogP | 7.24 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.12 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|