C24H31N2O6+ — CID 102134797
tert-butyl 2-[(2S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(4-nitrophenyl)methyl]aziridin-1-ium-1-yl]acetate (PubChem CID 102134797) has the molecular formula C24H31N2O6+ and a molecular weight of 443.52 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(4-nitrophenyl)methyl]aziridin-1-ium-1-yl]acetate.
| Compound Name | tert-butyl 2-[(2S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(4-nitrophenyl)methyl]aziridin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 102134797 |
| Molecular Formula | C24H31N2O6+ |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | tert-butyl 2-[(2S)-1-[(2,4-dimethoxyphenyl)methyl]-2-[(4-nitrophenyl)methyl]aziridin-1-ium-1-yl]acetate |
| SMILES | COc1ccc(C[N+]2(CC(=O)OC(C)(C)C)C[C@@H]2Cc2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C24H31N2O6/c1-24(2,3)32-23(27)16-26(14-18-8-11-21(30-4)13-22(18)31-5)15-20(26)12-17-6-9-19(10-7-17)25(28)29/h6-11,13,20H,12,14-16H2,1-5H3/q+1/t20-,26?/m0/s1 |
| InChIKey | MOVSYZPVLZTEED-DQUNLGLBSA-N |
| XLogP | 3.90 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|