C22H33N2O6+ — CID 59622840
tert-butyl 2-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-[2-(4-nitrophenyl)ethyl]aziridin-1-ium-1-yl]acetate (PubChem CID 59622840) has the molecular formula C22H33N2O6+ and a molecular weight of 421.51 g/mol. Its IUPAC name is tert-butyl 2-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-[2-(4-nitrophenyl)ethyl]aziridin-1-ium-1-yl]acetate.
| Compound Name | tert-butyl 2-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-[2-(4-nitrophenyl)ethyl]aziridin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 59622840 |
| Molecular Formula | C22H33N2O6+ |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | tert-butyl 2-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-2-[2-(4-nitrophenyl)ethyl]aziridin-1-ium-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[N+]1(CC(=O)OC(C)(C)C)CC1CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H33N2O6/c1-21(2,3)29-19(25)14-24(15-20(26)30-22(4,5)6)13-18(24)12-9-16-7-10-17(11-8-16)23(27)28/h7-8,10-11,18H,9,12-15H2,1-6H3/q+1 |
| InChIKey | BWFAYZKGOLLMRG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|