C21H29NO4 — CID 66828012
tert-butyl N-[(1R,6R)-6-bicyclo[3.2.0]hept-2-enyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate (PubChem CID 66828012) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl N-[(1R,6R)-6-bicyclo[3.2.0]hept-2-enyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(1R,6R)-6-bicyclo[3.2.0]hept-2-enyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 66828012 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | tert-butyl N-[(1R,6R)-6-bicyclo[3.2.0]hept-2-enyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CN(C(=O)OC(C)(C)C)[C@@H]2C[C@@H]3C=CCC23)c(OC)c1 |
| InChI | InChI=1S/C21H29NO4/c1-21(2,3)26-20(23)22(18-11-14-7-6-8-17(14)18)13-15-9-10-16(24-4)12-19(15)25-5/h6-7,9-10,12,14,17-18H,8,11,13H2,1-5H3/t14-,17?,18+/m0/s1 |
| InChIKey | ADTGMWDBEYAFAK-HXFVUSARSA-N |
| XLogP | 4.41 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|