C19H23N3O5 — CID 170412917
tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-(5-formylpyridazin-3-yl)carbamate (PubChem CID 170412917) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-(5-formylpyridazin-3-yl)carbamate.
| Compound Name | tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-(5-formylpyridazin-3-yl)carbamate |
|---|---|
| PubChem CID | 170412917 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | tert-butyl N-[(2,4-dimethoxyphenyl)methyl]-N-(5-formylpyridazin-3-yl)carbamate |
| SMILES | COc1ccc(CN(C(=O)OC(C)(C)C)c2cc(C=O)cnn2)c(OC)c1 |
| InChI | InChI=1S/C19H23N3O5/c1-19(2,3)27-18(24)22(17-8-13(12-23)10-20-21-17)11-14-6-7-15(25-4)9-16(14)26-5/h6-10,12H,11H2,1-5H3 |
| InChIKey | SODWJVCKPAHRID-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|