C27H36ClN3O6 — CID 138725738
tert-butyl N-[1-(1-chloroethyl)-3,3-diethyl-2-oxopyrido[2,3-b][1,4]oxazin-6-yl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate (PubChem CID 138725738) has the molecular formula C27H36ClN3O6 and a molecular weight of 534.05 g/mol. Its IUPAC name is tert-butyl N-[1-(1-chloroethyl)-3,3-diethyl-2-oxopyrido[2,3-b][1,4]oxazin-6-yl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[1-(1-chloroethyl)-3,3-diethyl-2-oxopyrido[2,3-b][1,4]oxazin-6-yl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 138725738 |
| Molecular Formula | C27H36ClN3O6 |
| Molecular Weight | 534.05 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | tert-butyl N-[1-(1-chloroethyl)-3,3-diethyl-2-oxopyrido[2,3-b][1,4]oxazin-6-yl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate |
| SMILES | CCC1(CC)Oc2nc(N(Cc3ccc(OC)cc3OC)C(=O)OC(C)(C)C)ccc2N(C(C)Cl)C1=O |
| InChI | InChI=1S/C27H36ClN3O6/c1-9-27(10-2)24(32)31(17(3)28)20-13-14-22(29-23(20)36-27)30(25(33)37-26(4,5)6)16-18-11-12-19(34-7)15-21(18)35-8/h11-15,17H,9-10,16H2,1-8H3 |
| InChIKey | CJCNPEKHCARTDP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 90.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.05 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|