C25H31NO7 — CID 142435917
tert-butyl 4-[(2,4-dimethoxyphenyl)methyl-(3-ethoxy-3-oxopropanoyl)amino]benzoate (PubChem CID 142435917) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is tert-butyl 4-[(2,4-dimethoxyphenyl)methyl-(3-ethoxy-3-oxopropanoyl)amino]benzoate.
| Compound Name | tert-butyl 4-[(2,4-dimethoxyphenyl)methyl-(3-ethoxy-3-oxopropanoyl)amino]benzoate |
|---|---|
| PubChem CID | 142435917 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | tert-butyl 4-[(2,4-dimethoxyphenyl)methyl-(3-ethoxy-3-oxopropanoyl)amino]benzoate |
| SMILES | CCOC(=O)CC(=O)N(Cc1ccc(OC)cc1OC)c1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H31NO7/c1-7-32-23(28)15-22(27)26(16-18-10-13-20(30-5)14-21(18)31-6)19-11-8-17(9-12-19)24(29)33-25(2,3)4/h8-14H,7,15-16H2,1-6H3 |
| InChIKey | RIKWSUDIKRRTDS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|