C20H25BrN2O3 — CID 135169140
tert-butyl N-[4-(bromomethyl)-6-methyl-2-pyridinyl]-N-[(4-methoxyphenyl)methyl]carbamate (PubChem CID 135169140) has the molecular formula C20H25BrN2O3 and a molecular weight of 421.34 g/mol. Its IUPAC name is tert-butyl N-[4-(bromomethyl)-6-methyl-2-pyridinyl]-N-[(4-methoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[4-(bromomethyl)-6-methyl-2-pyridinyl]-N-[(4-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 135169140 |
| Molecular Formula | C20H25BrN2O3 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | tert-butyl N-[4-(bromomethyl)-6-methyl-2-pyridinyl]-N-[(4-methoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CN(C(=O)OC(C)(C)C)c2cc(CBr)cc(C)n2)cc1 |
| InChI | InChI=1S/C20H25BrN2O3/c1-14-10-16(12-21)11-18(22-14)23(19(24)26-20(2,3)4)13-15-6-8-17(25-5)9-7-15/h6-11H,12-13H2,1-5H3 |
| InChIKey | AWKVHHSOASWAGH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|