C20H26N2O6 — CID 149075243
cyano 2-methoxy-4-[[(2-methylpropan-2-yl)oxycarbonyl-(oxan-4-yl)amino]methyl]benzoate (PubChem CID 149075243) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is cyano 2-methoxy-4-[[(2-methylpropan-2-yl)oxycarbonyl-(oxan-4-yl)amino]methyl]benzoate.
| Compound Name | cyano 2-methoxy-4-[[(2-methylpropan-2-yl)oxycarbonyl-(oxan-4-yl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 149075243 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | cyano 2-methoxy-4-[[(2-methylpropan-2-yl)oxycarbonyl-(oxan-4-yl)amino]methyl]benzoate |
| SMILES | COc1cc(CN(C(=O)OC(C)(C)C)C2CCOCC2)ccc1C(=O)OC#N |
| InChI | InChI=1S/C20H26N2O6/c1-20(2,3)28-19(24)22(15-7-9-26-10-8-15)12-14-5-6-16(17(11-14)25-4)18(23)27-13-21/h5-6,11,15H,7-10,12H2,1-4H3 |
| InChIKey | QOVYXEJJLUBWLM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 98.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|