C27H33IN2O5S — CID 130353092
tert-butyl N-[[1-(benzenesulfonyl)-3-ethyl-2-iodoindol-6-yl]methyl]-N-(oxan-4-yl)carbamate (PubChem CID 130353092) has the molecular formula C27H33IN2O5S and a molecular weight of 624.54 g/mol. Its IUPAC name is tert-butyl N-[[1-(benzenesulfonyl)-3-ethyl-2-iodoindol-6-yl]methyl]-N-(oxan-4-yl)carbamate.
| Compound Name | tert-butyl N-[[1-(benzenesulfonyl)-3-ethyl-2-iodoindol-6-yl]methyl]-N-(oxan-4-yl)carbamate |
|---|---|
| PubChem CID | 130353092 |
| Molecular Formula | C27H33IN2O5S |
| Molecular Weight | 624.54 g/mol |
| Exact Mass | 624.12 |
| IUPAC Name | tert-butyl N-[[1-(benzenesulfonyl)-3-ethyl-2-iodoindol-6-yl]methyl]-N-(oxan-4-yl)carbamate |
| SMILES | CCc1c(I)n(S(=O)(=O)c2ccccc2)c2cc(CN(C(=O)OC(C)(C)C)C3CCOCC3)ccc12 |
| InChI | InChI=1S/C27H33IN2O5S/c1-5-22-23-12-11-19(18-29(20-13-15-34-16-14-20)26(31)35-27(2,3)4)17-24(23)30(25(22)28)36(32,33)21-9-7-6-8-10-21/h6-12,17,20H,5,13-16,18H2,1-4H3 |
| InChIKey | SUIJCVGMOSQFDF-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|