C26H33N3O3 — CID 126583534
tert-butyl N-[[3-benzyl-1-(3-hydroxypropyl)indazol-6-yl]methyl]-N-cyclopropylcarbamate (PubChem CID 126583534) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is tert-butyl N-[[3-benzyl-1-(3-hydroxypropyl)indazol-6-yl]methyl]-N-cyclopropylcarbamate.
| Compound Name | tert-butyl N-[[3-benzyl-1-(3-hydroxypropyl)indazol-6-yl]methyl]-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 126583534 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | tert-butyl N-[[3-benzyl-1-(3-hydroxypropyl)indazol-6-yl]methyl]-N-cyclopropylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc2c(Cc3ccccc3)nn(CCCO)c2c1)C1CC1 |
| InChI | InChI=1S/C26H33N3O3/c1-26(2,3)32-25(31)28(21-11-12-21)18-20-10-13-22-23(16-19-8-5-4-6-9-19)27-29(14-7-15-30)24(22)17-20/h4-6,8-10,13,17,21,30H,7,11-12,14-16,18H2,1-3H3 |
| InChIKey | YMURSVXXRAUDMX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |