C17H15NO4 — CID 143848879
7-(2-aminoethoxy)-8-hydroxy-4-phenylchromen-2-one (PubChem CID 143848879) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 7-(2-aminoethoxy)-8-hydroxy-4-phenylchromen-2-one.
| Compound Name | 7-(2-aminoethoxy)-8-hydroxy-4-phenylchromen-2-one |
|---|---|
| PubChem CID | 143848879 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 7-(2-aminoethoxy)-8-hydroxy-4-phenylchromen-2-one |
| SMILES | NCCOc1ccc2c(-c3ccccc3)cc(=O)oc2c1O |
| InChI | InChI=1S/C17H15NO4/c18-8-9-21-14-7-6-12-13(11-4-2-1-3-5-11)10-15(19)22-17(12)16(14)20/h1-7,10,20H,8-9,18H2 |
| InChIKey | IVOYMVBCXNBRBR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|