C22H21FO5 — CID 86651375
8-(2-fluoroethoxy)-7-(oxan-2-yloxy)-4-phenylchromen-2-one (PubChem CID 86651375) has the molecular formula C22H21FO5 and a molecular weight of 384.40 g/mol. Its IUPAC name is 8-(2-fluoroethoxy)-7-(oxan-2-yloxy)-4-phenylchromen-2-one.
| Compound Name | 8-(2-fluoroethoxy)-7-(oxan-2-yloxy)-4-phenylchromen-2-one |
|---|---|
| PubChem CID | 86651375 |
| Molecular Formula | C22H21FO5 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 8-(2-fluoroethoxy)-7-(oxan-2-yloxy)-4-phenylchromen-2-one |
| SMILES | O=c1cc(-c2ccccc2)c2ccc(OC3CCCCO3)c(OCCF)c2o1 |
| InChI | InChI=1S/C22H21FO5/c23-11-13-26-22-18(27-20-8-4-5-12-25-20)10-9-16-17(14-19(24)28-21(16)22)15-6-2-1-3-7-15/h1-3,6-7,9-10,14,20H,4-5,8,11-13H2 |
| InChIKey | NMBSTELTBLTFHT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|