C21H16N2O6 — CID 46933635
1-[2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxyacetyl]pyrazolidine-3,5-dione (PubChem CID 46933635) has the molecular formula C21H16N2O6 and a molecular weight of 392.37 g/mol. Its IUPAC name is 1-[2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxyacetyl]pyrazolidine-3,5-dione.
| Compound Name | 1-[2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxyacetyl]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 46933635 |
| Molecular Formula | C21H16N2O6 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1-[2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxyacetyl]pyrazolidine-3,5-dione |
| SMILES | Cc1c(OCC(=O)N2NC(=O)CC2=O)ccc2c(-c3ccccc3)cc(=O)oc12 |
| InChI | InChI=1S/C21H16N2O6/c1-12-16(28-11-19(26)23-18(25)10-17(24)22-23)8-7-14-15(9-20(27)29-21(12)14)13-5-3-2-4-6-13/h2-9H,10-11H2,1H3,(H,22,24) |
| InChIKey | YREVFKSPRJISHX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|