C27H21NO6 — CID 171340374
4-methyl-6-[2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxyacetyl]-1,4-benzoxazin-3-one (PubChem CID 171340374) has the molecular formula C27H21NO6 and a molecular weight of 455.47 g/mol. Its IUPAC name is 4-methyl-6-[2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxyacetyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-methyl-6-[2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxyacetyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 171340374 |
| Molecular Formula | C27H21NO6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-methyl-6-[2-(8-methyl-2-oxo-4-phenylchromen-7-yl)oxyacetyl]-1,4-benzoxazin-3-one |
| SMILES | Cc1c(OCC(=O)c2ccc3c(c2)N(C)C(=O)CO3)ccc2c(-c3ccccc3)cc(=O)oc12 |
| InChI | InChI=1S/C27H21NO6/c1-16-23(11-9-19-20(13-26(31)34-27(16)19)17-6-4-3-5-7-17)32-14-22(29)18-8-10-24-21(12-18)28(2)25(30)15-33-24/h3-13H,14-15H2,1-2H3 |
| InChIKey | GJLSJHMRERUTJI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|