C12H11NO5 — CID 116917982
3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-3-oxopropanoic acid (PubChem CID 116917982) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-3-oxopropanoic acid.
| Compound Name | 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 116917982 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)-3-oxopropanoic acid |
| SMILES | CN1C(=O)COc2ccc(C(=O)CC(=O)O)cc21 |
| InChI | InChI=1S/C12H11NO5/c1-13-8-4-7(9(14)5-12(16)17)2-3-10(8)18-6-11(13)15/h2-4H,5-6H2,1H3,(H,16,17) |
| InChIKey | CXKZSMATCUODAK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|