C11H8N2O3 — CID 116918990
4-methyl-3-oxo-1,4-benzoxazine-6-carbonyl cyanide (PubChem CID 116918990) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 4-methyl-3-oxo-1,4-benzoxazine-6-carbonyl cyanide.
| Compound Name | 4-methyl-3-oxo-1,4-benzoxazine-6-carbonyl cyanide |
|---|---|
| PubChem CID | 116918990 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4-methyl-3-oxo-1,4-benzoxazine-6-carbonyl cyanide |
| SMILES | CN1C(=O)COc2ccc(C(=O)C#N)cc21 |
| InChI | InChI=1S/C11H8N2O3/c1-13-8-4-7(9(14)5-12)2-3-10(8)16-6-11(13)15/h2-4H,6H2,1H3 |
| InChIKey | TZYHPJCKYYVKEA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|