C12H14N2O3 — CID 115191036
N-methyl-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)acetamide (PubChem CID 115191036) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is N-methyl-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)acetamide.
| Compound Name | N-methyl-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)acetamide |
|---|---|
| PubChem CID | 115191036 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-methyl-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)acetamide |
| SMILES | CC(=O)N(C)c1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C12H14N2O3/c1-8(15)13(2)9-4-5-11-10(6-9)14(3)12(16)7-17-11/h4-6H,7H2,1-3H3 |
| InChIKey | LWWYKILRTVUUER-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |