C12H15ClN2O2 — CID 115214739
6-[2-chloroethyl(methyl)amino]-4-methyl-1,4-benzoxazin-3-one (PubChem CID 115214739) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 6-[2-chloroethyl(methyl)amino]-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-chloroethyl(methyl)amino]-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115214739 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 6-[2-chloroethyl(methyl)amino]-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN(CCCl)c1ccc2c(c1)N(C)C(=O)CO2 |
| InChI | InChI=1S/C12H15ClN2O2/c1-14(6-5-13)9-3-4-11-10(7-9)15(2)12(16)8-17-11/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | DPUWZPUWHYJMCN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|