C13H15BrN2O3 — CID 115194115
N-methyl-N-[2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)ethyl]carbamoyl bromide (PubChem CID 115194115) has the molecular formula C13H15BrN2O3 and a molecular weight of 327.18 g/mol. Its IUPAC name is N-methyl-N-[2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)ethyl]carbamoyl bromide.
| Compound Name | N-methyl-N-[2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)ethyl]carbamoyl bromide |
|---|---|
| PubChem CID | 115194115 |
| Molecular Formula | C13H15BrN2O3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | N-methyl-N-[2-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)ethyl]carbamoyl bromide |
| SMILES | CN(CCc1ccc2c(c1)N(C)C(=O)CO2)C(=O)Br |
| InChI | InChI=1S/C13H15BrN2O3/c1-15(13(14)18)6-5-9-3-4-11-10(7-9)16(2)12(17)8-19-11/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | BYIMORFYKKPMAN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|