C12H17N3O2 — CID 115226078
6-[2-(aminomethylamino)ethyl]-4-methyl-1,4-benzoxazin-3-one (PubChem CID 115226078) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-[2-(aminomethylamino)ethyl]-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(aminomethylamino)ethyl]-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 115226078 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-[2-(aminomethylamino)ethyl]-4-methyl-1,4-benzoxazin-3-one |
| SMILES | CN1C(=O)COc2ccc(CCNCN)cc21 |
| InChI | InChI=1S/C12H17N3O2/c1-15-10-6-9(4-5-14-8-13)2-3-11(10)17-7-12(15)16/h2-3,6,14H,4-5,7-8,13H2,1H3 |
| InChIKey | ICZLJNURQIDXAL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|