C20H25NO7 — CID 91426802
3-[2-ethoxy-1-(methoxyamino)ethenyl]-4-hydroxy-8-methyl-7-(oxan-2-yloxy)chromen-2-one (PubChem CID 91426802) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-[2-ethoxy-1-(methoxyamino)ethenyl]-4-hydroxy-8-methyl-7-(oxan-2-yloxy)chromen-2-one.
| Compound Name | 3-[2-ethoxy-1-(methoxyamino)ethenyl]-4-hydroxy-8-methyl-7-(oxan-2-yloxy)chromen-2-one |
|---|---|
| PubChem CID | 91426802 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-[2-ethoxy-1-(methoxyamino)ethenyl]-4-hydroxy-8-methyl-7-(oxan-2-yloxy)chromen-2-one |
| SMILES | CCOC=C(NOC)c1c(O)c2ccc(OC3CCCCO3)c(C)c2oc1=O |
| InChI | InChI=1S/C20H25NO7/c1-4-25-11-14(21-24-3)17-18(22)13-8-9-15(12(2)19(13)28-20(17)23)27-16-7-5-6-10-26-16/h8-9,11,16,21-22H,4-7,10H2,1-3H3 |
| InChIKey | YONBYUNRKZZYDF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|