C16H19FO5 — CID 18328186
methyl (E)-3-(fluoromethoxy)-2-[2-(oxan-2-yloxy)phenyl]prop-2-enoate (PubChem CID 18328186) has the molecular formula C16H19FO5 and a molecular weight of 310.32 g/mol. Its IUPAC name is methyl (E)-3-(fluoromethoxy)-2-[2-(oxan-2-yloxy)phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-(fluoromethoxy)-2-[2-(oxan-2-yloxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 18328186 |
| Molecular Formula | C16H19FO5 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | methyl (E)-3-(fluoromethoxy)-2-[2-(oxan-2-yloxy)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C(=C/OCF)c1ccccc1OC1CCCCO1 |
| InChI | InChI=1S/C16H19FO5/c1-19-16(18)13(10-20-11-17)12-6-2-3-7-14(12)22-15-8-4-5-9-21-15/h2-3,6-7,10,15H,4-5,8-9,11H2,1H3/b13-10+ |
| InChIKey | DQUYPQYJJBMMCU-JLHYYAGUSA-N |
| XLogP | 3.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|