C15H11F3N2O4 — CID 67702590
methyl 2-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-3-(fluoromethoxy)prop-2-enoate (PubChem CID 67702590) has the molecular formula C15H11F3N2O4 and a molecular weight of 340.26 g/mol. Its IUPAC name is methyl 2-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-3-(fluoromethoxy)prop-2-enoate.
| Compound Name | methyl 2-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-3-(fluoromethoxy)prop-2-enoate |
|---|---|
| PubChem CID | 67702590 |
| Molecular Formula | C15H11F3N2O4 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | methyl 2-[2-(5,6-difluoropyrimidin-4-yl)oxyphenyl]-3-(fluoromethoxy)prop-2-enoate |
| SMILES | COC(=O)C(=COCF)c1ccccc1Oc1ncnc(F)c1F |
| InChI | InChI=1S/C15H11F3N2O4/c1-22-15(21)10(6-23-7-16)9-4-2-3-5-11(9)24-14-12(17)13(18)19-8-20-14/h2-6,8H,7H2,1H3 |
| InChIKey | FFWUOYAZRFAYJJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|