C25H29NO9S — CID 173231610
7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-3-[C-methyl-N-(thiophen-3-ylmethoxy)carbonimidoyl]chromen-2-one (PubChem CID 173231610) has the molecular formula C25H29NO9S and a molecular weight of 519.57 g/mol. Its IUPAC name is 7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-3-[C-methyl-N-(thiophen-3-ylmethoxy)carbonimidoyl]chromen-2-one.
| Compound Name | 7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-3-[C-methyl-N-(thiophen-3-ylmethoxy)carbonimidoyl]chromen-2-one |
|---|---|
| PubChem CID | 173231610 |
| Molecular Formula | C25H29NO9S |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 7-[(2R,3R,4R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-4-hydroxy-8-methyl-3-[C-methyl-N-(thiophen-3-ylmethoxy)carbonimidoyl]chromen-2-one |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](O)[C@H](Oc2ccc3c(O)c(C(C)=NOCc4ccsc4)c(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C25H29NO9S/c1-12-16(33-24-20(29)19(28)22(31-5)25(3,4)35-24)7-6-15-18(27)17(23(30)34-21(12)15)13(2)26-32-10-14-8-9-36-11-14/h6-9,11,19-20,22,24,27-29H,10H2,1-5H3/t19-,20-,22-,24-/m1/s1 |
| InChIKey | CBHKAJCYWIRGEO-QVHJCDIPSA-N |
| XLogP | 3.06 |
| TPSA | 140.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|