C27H34N2O11 — CID 136623602
[(2S,3R,4S,5R)-2-ethyl-6-[3-(C-ethyl-N-methoxycarbonimidoyl)-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2-methyloxan-4-yl] N-prop-2-ynoxycarbamate (PubChem CID 136623602) has the molecular formula C27H34N2O11 and a molecular weight of 562.57 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-2-ethyl-6-[3-(C-ethyl-N-methoxycarbonimidoyl)-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2-methyloxan-4-yl] N-prop-2-ynoxycarbamate.
| Compound Name | [(2S,3R,4S,5R)-2-ethyl-6-[3-(C-ethyl-N-methoxycarbonimidoyl)-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2-methyloxan-4-yl] N-prop-2-ynoxycarbamate |
|---|---|
| PubChem CID | 136623602 |
| Molecular Formula | C27H34N2O11 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | [(2S,3R,4S,5R)-2-ethyl-6-[3-(C-ethyl-N-methoxycarbonimidoyl)-4-hydroxy-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2-methyloxan-4-yl] N-prop-2-ynoxycarbamate |
| SMILES | C#CCONC(=O)O[C@@H]1[C@@H](OC)[C@](C)(CC)OC(Oc2ccc3c(O)c(C(CC)=NOC)c(=O)oc3c2C)[C@@H]1O |
| InChI | InChI=1S/C27H34N2O11/c1-8-13-36-29-26(33)39-22-20(31)25(40-27(5,10-3)23(22)34-6)37-17-12-11-15-19(30)18(16(9-2)28-35-7)24(32)38-21(15)14(17)4/h1,11-12,20,22-23,25,30-31H,9-10,13H2,2-7H3,(H,29,33)/t20-,22+,23-,25?,27+/m1/s1 |
| InChIKey | BRVKILPDRKIYAE-UITVAVGZSA-N |
| XLogP | 2.51 |
| TPSA | 167.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|