C26H30N4O9 — CID 100940023
[(3R,4S,5R,6R)-6-[4-(2-azidoethoxy)-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate (PubChem CID 100940023) has the molecular formula C26H30N4O9 and a molecular weight of 542.55 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-6-[4-(2-azidoethoxy)-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | [(3R,4S,5R,6R)-6-[4-(2-azidoethoxy)-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 100940023 |
| Molecular Formula | C26H30N4O9 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | [(3R,4S,5R,6R)-6-[4-(2-azidoethoxy)-8-methyl-2-oxochromen-7-yl]oxy-5-hydroxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CO[C@@H]1[C@@H](OC(=O)c2ccc(C)[nH]2)[C@@H](O)[C@H](Oc2ccc3c(OCCN=[N+]=[N-])cc(=O)oc3c2C)OC1(C)C |
| InChI | InChI=1S/C26H30N4O9/c1-13-6-8-16(29-13)24(33)38-22-20(32)25(39-26(3,4)23(22)34-5)36-17-9-7-15-18(35-11-10-28-30-27)12-19(31)37-21(15)14(17)2/h6-9,12,20,22-23,25,29,32H,10-11H2,1-5H3/t20-,22+,23-,25-/m1/s1 |
| InChIKey | MAKCZOFVOMLDPE-JVICHNFNSA-N |
| XLogP | 3.54 |
| TPSA | 178.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|