C14H23NO2 — CID 103032538
4-(3-methoxy-3-methylbutoxy)-3,5-dimethylaniline (PubChem CID 103032538) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 4-(3-methoxy-3-methylbutoxy)-3,5-dimethylaniline.
| Compound Name | 4-(3-methoxy-3-methylbutoxy)-3,5-dimethylaniline |
|---|---|
| PubChem CID | 103032538 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4-(3-methoxy-3-methylbutoxy)-3,5-dimethylaniline |
| SMILES | COC(C)(C)CCOc1c(C)cc(N)cc1C |
| InChI | InChI=1S/C14H23NO2/c1-10-8-12(15)9-11(2)13(10)17-7-6-14(3,4)16-5/h8-9H,6-7,15H2,1-5H3 |
| InChIKey | QNCZEZXITKCLMV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|