C10H16BrN3O2 — CID 106668961
6-bromo-2-(3-methoxy-3-methylbutoxy)pyrimidin-4-amine (PubChem CID 106668961) has the molecular formula C10H16BrN3O2 and a molecular weight of 290.16 g/mol. Its IUPAC name is 6-bromo-2-(3-methoxy-3-methylbutoxy)pyrimidin-4-amine.
| Compound Name | 6-bromo-2-(3-methoxy-3-methylbutoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106668961 |
| Molecular Formula | C10H16BrN3O2 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 6-bromo-2-(3-methoxy-3-methylbutoxy)pyrimidin-4-amine |
| SMILES | COC(C)(C)CCOc1nc(N)cc(Br)n1 |
| InChI | InChI=1S/C10H16BrN3O2/c1-10(2,15-3)4-5-16-9-13-7(11)6-8(12)14-9/h6H,4-5H2,1-3H3,(H2,12,13,14) |
| InChIKey | DTCFDQBAHLBKQI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |