C19H31NO6 — CID 169248258
N-[5-tert-butyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]formamide (PubChem CID 169248258) has the molecular formula C19H31NO6 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-[5-tert-butyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]formamide.
| Compound Name | N-[5-tert-butyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]formamide |
|---|---|
| PubChem CID | 169248258 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-[5-tert-butyl-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]formamide |
| SMILES | CC(C)(C)c1ccc(OCCOCCOCCOCCO)c(NC=O)c1 |
| InChI | InChI=1S/C19H31NO6/c1-19(2,3)16-4-5-18(17(14-16)20-15-22)26-13-12-25-11-10-24-9-8-23-7-6-21/h4-5,14-15,21H,6-13H2,1-3H3,(H,20,22) |
| InChIKey | DMUQQPJAVNHAHY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|