C29H36O6 — CID 57430933
[(2E)-3,7-dimethylocta-2,7-dienyl] 4-[(E)-2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]benzoate (PubChem CID 57430933) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,7-dienyl] 4-[(E)-2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]benzoate.
| Compound Name | [(2E)-3,7-dimethylocta-2,7-dienyl] 4-[(E)-2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 57430933 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,7-dienyl] 4-[(E)-2-[3,4-bis(methoxymethoxy)phenyl]ethenyl]benzoate |
| SMILES | C=C(C)CCC/C(C)=C/COC(=O)c1ccc(/C=C/c2ccc(OCOC)c(OCOC)c2)cc1 |
| InChI | InChI=1S/C29H36O6/c1-22(2)7-6-8-23(3)17-18-33-29(30)26-14-11-24(12-15-26)9-10-25-13-16-27(34-20-31-4)28(19-25)35-21-32-5/h9-17,19H,1,6-8,18,20-21H2,2-5H3/b10-9+,23-17+ |
| InChIKey | WIBFSBJIVUBGTB-MUVRPNDMSA-N |
| XLogP | 6.67 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|