C38H36O6 — CID 145426208
2-[4-[(E)-2-[3,5-bis[(E)-2-[4-(carboxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]acetic acid;ethane (PubChem CID 145426208) has the molecular formula C38H36O6 and a molecular weight of 588.70 g/mol. Its IUPAC name is 2-[4-[(E)-2-[3,5-bis[(E)-2-[4-(carboxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]acetic acid;ethane.
| Compound Name | 2-[4-[(E)-2-[3,5-bis[(E)-2-[4-(carboxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]acetic acid;ethane |
|---|---|
| PubChem CID | 145426208 |
| Molecular Formula | C38H36O6 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | 2-[4-[(E)-2-[3,5-bis[(E)-2-[4-(carboxymethyl)phenyl]ethenyl]phenyl]ethenyl]phenyl]acetic acid;ethane |
| SMILES | CC.O=C(O)Cc1ccc(/C=C/c2cc(/C=C/c3ccc(CC(=O)O)cc3)cc(/C=C/c3ccc(CC(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C36H30O6.C2H6/c37-34(38)22-28-10-1-25(2-11-28)7-16-31-19-32(17-8-26-3-12-29(13-4-26)23-35(39)40)21-33(20-31)18-9-27-5-14-30(15-6-27)24-36(41)42;1-2/h1-21H,22-24H2,(H,37,38)(H,39,40)(H,41,42);1-2H3/b16-7+,17-8+,18-9+; |
| InChIKey | HZIDMKYZMNNPIS-KGJMFOAOSA-N |
| XLogP | 8.11 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|