C15H14N2O3S — CID 87597036
2-[4-[(E)-2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]phenyl]acetic acid (PubChem CID 87597036) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-[4-[(E)-2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(E)-2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 87597036 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-[4-[(E)-2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]phenyl]acetic acid |
| SMILES | CC(=O)Nc1nc(/C=C/c2ccc(CC(=O)O)cc2)cs1 |
| InChI | InChI=1S/C15H14N2O3S/c1-10(18)16-15-17-13(9-21-15)7-6-11-2-4-12(5-3-11)8-14(19)20/h2-7,9H,8H2,1H3,(H,19,20)(H,16,17,18)/b7-6+ |
| InChIKey | VOUIKXJMPKEJLI-VOTSOKGWSA-N |
| XLogP | 2.90 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |