C15H14N2O3S2 — CID 173025649
3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]thiophen-2-yl]-2-methylprop-2-enoic acid (PubChem CID 173025649) has the molecular formula C15H14N2O3S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]thiophen-2-yl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]thiophen-2-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 173025649 |
| Molecular Formula | C15H14N2O3S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]thiophen-2-yl]-2-methylprop-2-enoic acid |
| SMILES | CC(=O)Nc1nc(C=Cc2csc(C=C(C)C(=O)O)c2)cs1 |
| InChI | InChI=1S/C15H14N2O3S2/c1-9(14(19)20)5-13-6-11(7-21-13)3-4-12-8-22-15(17-12)16-10(2)18/h3-8H,1-2H3,(H,19,20)(H,16,17,18) |
| InChIKey | UXIGHAVVLARZQT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|