C14H11FN2O3S — CID 87182657
4-[(E)-2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]-3-fluorobenzoic acid (PubChem CID 87182657) has the molecular formula C14H11FN2O3S and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-[(E)-2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]-3-fluorobenzoic acid.
| Compound Name | 4-[(E)-2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 87182657 |
| Molecular Formula | C14H11FN2O3S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 4-[(E)-2-(2-acetamido-1,3-thiazol-4-yl)ethenyl]-3-fluorobenzoic acid |
| SMILES | CC(=O)Nc1nc(/C=C/c2ccc(C(=O)O)cc2F)cs1 |
| InChI | InChI=1S/C14H11FN2O3S/c1-8(18)16-14-17-11(7-21-14)5-4-9-2-3-10(13(19)20)6-12(9)15/h2-7H,1H3,(H,19,20)(H,16,17,18)/b5-4+ |
| InChIKey | AZUOLFYEVDVRIE-SNAWJCMRSA-N |
| XLogP | 3.11 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |