C11H12N2O2S — CID 47066446
N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 47066446) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 47066446 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(-c2cc(C)oc2C)cs1 |
| InChI | InChI=1S/C11H12N2O2S/c1-6-4-9(7(2)15-6)10-5-16-11(13-10)12-8(3)14/h4-5H,1-3H3,(H,12,13,14) |
| InChIKey | FHCGPZFWQJPYAQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |