C21H21N3O4S — CID 56564971
N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide (PubChem CID 56564971) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide.
| Compound Name | N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 56564971 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | N-[4-(2,5-dimethylfuran-3-yl)-1,3-thiazol-2-yl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide |
| SMILES | Cc1cc(-c2csc(NC(=O)c3cc4c([nH]c3=O)CC(C)(C)CC4=O)n2)c(C)o1 |
| InChI | InChI=1S/C21H21N3O4S/c1-10-5-12(11(2)28-10)16-9-29-20(23-16)24-19(27)14-6-13-15(22-18(14)26)7-21(3,4)8-17(13)25/h5-6,9H,7-8H2,1-4H3,(H,22,26)(H,23,24,27) |
| InChIKey | ALFUUWWTCKOXND-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |