C22H19N3O5S — CID 56562122
N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide (PubChem CID 56562122) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 56562122 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)Nc3nc(-c4ccc5c(c4)OCO5)cs3)c(=O)[nH]c2C1 |
| InChI | InChI=1S/C22H19N3O5S/c1-22(2)7-14-12(16(26)8-22)6-13(19(27)23-14)20(28)25-21-24-15(9-31-21)11-3-4-17-18(5-11)30-10-29-17/h3-6,9H,7-8,10H2,1-2H3,(H,23,27)(H,24,25,28) |
| InChIKey | HISAZFKCIAYFNG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |