C17H10ClN3O5S — CID 2329434
N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-chloro-5-nitrobenzamide (PubChem CID 2329434) has the molecular formula C17H10ClN3O5S and a molecular weight of 403.80 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-chloro-5-nitrobenzamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-chloro-5-nitrobenzamide |
|---|---|
| PubChem CID | 2329434 |
| Molecular Formula | C17H10ClN3O5S |
| Molecular Weight | 403.80 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-2-chloro-5-nitrobenzamide |
| SMILES | O=C(Nc1nc(-c2ccc3c(c2)OCO3)cs1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H10ClN3O5S/c18-12-3-2-10(21(23)24)6-11(12)16(22)20-17-19-13(7-27-17)9-1-4-14-15(5-9)26-8-25-14/h1-7H,8H2,(H,19,20,22) |
| InChIKey | UPQOVAISHWKVPR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.80 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|