C20H18O6 — CID 122584891
2-[2,3-bis(carboxymethyl)-5-[(E)-2-phenylethenyl]phenyl]acetic acid (PubChem CID 122584891) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-[2,3-bis(carboxymethyl)-5-[(E)-2-phenylethenyl]phenyl]acetic acid.
| Compound Name | 2-[2,3-bis(carboxymethyl)-5-[(E)-2-phenylethenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 122584891 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-[2,3-bis(carboxymethyl)-5-[(E)-2-phenylethenyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(/C=C/c2ccccc2)cc(CC(=O)O)c1CC(=O)O |
| InChI | InChI=1S/C20H18O6/c21-18(22)10-15-8-14(7-6-13-4-2-1-3-5-13)9-16(11-19(23)24)17(15)12-20(25)26/h1-9H,10-12H2,(H,21,22)(H,23,24)(H,25,26)/b7-6+ |
| InChIKey | XINDWMIWLBBGLQ-VOTSOKGWSA-N |
| XLogP | 2.74 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|