C20H21FO4 — CID 169018324
(E)-3-(4-fluorophenyl)-1-(2,4,6-trimethoxy-3,5-dimethylphenyl)prop-2-en-1-one (PubChem CID 169018324) has the molecular formula C20H21FO4 and a molecular weight of 344.38 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-1-(2,4,6-trimethoxy-3,5-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-fluorophenyl)-1-(2,4,6-trimethoxy-3,5-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 169018324 |
| Molecular Formula | C20H21FO4 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-1-(2,4,6-trimethoxy-3,5-dimethylphenyl)prop-2-en-1-one |
| SMILES | COc1c(C)c(OC)c(C(=O)/C=C/c2ccc(F)cc2)c(OC)c1C |
| InChI | InChI=1S/C20H21FO4/c1-12-18(23-3)13(2)20(25-5)17(19(12)24-4)16(22)11-8-14-6-9-15(21)10-7-14/h6-11H,1-5H3/b11-8+ |
| InChIKey | UCVZANXECNWMEJ-DHZHZOJOSA-N |
| XLogP | 4.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|