C20H22O6S — CID 169018392
(E)-1-[2-hydroxy-6-methoxy-4-(methoxymethoxy)-3,5-dimethylphenyl]-3-(4-hydroxysulfanylphenyl)prop-2-en-1-one (PubChem CID 169018392) has the molecular formula C20H22O6S and a molecular weight of 390.46 g/mol. Its IUPAC name is (E)-1-[2-hydroxy-6-methoxy-4-(methoxymethoxy)-3,5-dimethylphenyl]-3-(4-hydroxysulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-hydroxy-6-methoxy-4-(methoxymethoxy)-3,5-dimethylphenyl]-3-(4-hydroxysulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 169018392 |
| Molecular Formula | C20H22O6S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (E)-1-[2-hydroxy-6-methoxy-4-(methoxymethoxy)-3,5-dimethylphenyl]-3-(4-hydroxysulfanylphenyl)prop-2-en-1-one |
| SMILES | COCOc1c(C)c(O)c(C(=O)/C=C/c2ccc(SO)cc2)c(OC)c1C |
| InChI | InChI=1S/C20H22O6S/c1-12-18(22)17(20(25-4)13(2)19(12)26-11-24-3)16(21)10-7-14-5-8-15(27-23)9-6-14/h5-10,22-23H,11H2,1-4H3/b10-7+ |
| InChIKey | COQBRFILYLRUGM-JXMROGBWSA-N |
| XLogP | 4.46 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|