C17H18O5 — CID 133083417
(E)-3-(furan-2-yl)-1-(2-hydroxy-4,6-dimethoxy-3,5-dimethylphenyl)prop-2-en-1-one (PubChem CID 133083417) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-1-(2-hydroxy-4,6-dimethoxy-3,5-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(furan-2-yl)-1-(2-hydroxy-4,6-dimethoxy-3,5-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 133083417 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (E)-3-(furan-2-yl)-1-(2-hydroxy-4,6-dimethoxy-3,5-dimethylphenyl)prop-2-en-1-one |
| SMILES | COc1c(C)c(O)c(C(=O)/C=C/c2ccco2)c(OC)c1C |
| InChI | InChI=1S/C17H18O5/c1-10-15(19)14(17(21-4)11(2)16(10)20-3)13(18)8-7-12-6-5-9-22-12/h5-9,19H,1-4H3/b8-7+ |
| InChIKey | ZOWUOFGTHDDRET-BQYQJAHWSA-N |
| XLogP | 3.52 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|