C21H27NO5 — CID 138507975
(E)-1-[3-[[ethyl(2-methoxyethyl)amino]methyl]-2-hydroxy-6-methoxy-4-methylphenyl]-3-(furan-2-yl)prop-2-en-1-one (PubChem CID 138507975) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is (E)-1-[3-[[ethyl(2-methoxyethyl)amino]methyl]-2-hydroxy-6-methoxy-4-methylphenyl]-3-(furan-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[[ethyl(2-methoxyethyl)amino]methyl]-2-hydroxy-6-methoxy-4-methylphenyl]-3-(furan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 138507975 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (E)-1-[3-[[ethyl(2-methoxyethyl)amino]methyl]-2-hydroxy-6-methoxy-4-methylphenyl]-3-(furan-2-yl)prop-2-en-1-one |
| SMILES | CCN(CCOC)Cc1c(C)cc(OC)c(C(=O)/C=C/c2ccco2)c1O |
| InChI | InChI=1S/C21H27NO5/c1-5-22(10-12-25-3)14-17-15(2)13-19(26-4)20(21(17)24)18(23)9-8-16-7-6-11-27-16/h6-9,11,13,24H,5,10,12,14H2,1-4H3/b9-8+ |
| InChIKey | QJAARMXYQMEETC-CMDGGOBGSA-N |
| XLogP | 3.67 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|