C24H31NO6 — CID 25208788
(E)-1-[3-(diethylaminomethyl)-2-hydroxy-4,6-bis(methoxymethoxy)phenyl]-3-phenylprop-2-en-1-one (PubChem CID 25208788) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is (E)-1-[3-(diethylaminomethyl)-2-hydroxy-4,6-bis(methoxymethoxy)phenyl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[3-(diethylaminomethyl)-2-hydroxy-4,6-bis(methoxymethoxy)phenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 25208788 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (E)-1-[3-(diethylaminomethyl)-2-hydroxy-4,6-bis(methoxymethoxy)phenyl]-3-phenylprop-2-en-1-one |
| SMILES | CCN(CC)Cc1c(OCOC)cc(OCOC)c(C(=O)/C=C/c2ccccc2)c1O |
| InChI | InChI=1S/C24H31NO6/c1-5-25(6-2)15-19-21(30-16-28-3)14-22(31-17-29-4)23(24(19)27)20(26)13-12-18-10-8-7-9-11-18/h7-14,27H,5-6,15-17H2,1-4H3/b13-12+ |
| InChIKey | PMUBEJTZOIWMSW-OUKQBFOZSA-N |
| XLogP | 4.10 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|