C20H15ClFNO5 — CID 139466938
N-[[3-chloro-4-(4-fluorophenoxy)phenyl]methyl]-2,4,6-trihydroxybenzamide (PubChem CID 139466938) has the molecular formula C20H15ClFNO5 and a molecular weight of 403.79 g/mol. Its IUPAC name is N-[[3-chloro-4-(4-fluorophenoxy)phenyl]methyl]-2,4,6-trihydroxybenzamide.
| Compound Name | N-[[3-chloro-4-(4-fluorophenoxy)phenyl]methyl]-2,4,6-trihydroxybenzamide |
|---|---|
| PubChem CID | 139466938 |
| Molecular Formula | C20H15ClFNO5 |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | N-[[3-chloro-4-(4-fluorophenoxy)phenyl]methyl]-2,4,6-trihydroxybenzamide |
| SMILES | O=C(NCc1ccc(Oc2ccc(F)cc2)c(Cl)c1)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C20H15ClFNO5/c21-15-7-11(1-6-18(15)28-14-4-2-12(22)3-5-14)10-23-20(27)19-16(25)8-13(24)9-17(19)26/h1-9,24-26H,10H2,(H,23,27) |
| InChIKey | WMBWRKRQGCEQBA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |