C32H30NaO8P — CID 157218973
sodium bis[4-[3-(2-hydroxyphenyl)-3-oxopropyl]-3-methylphenyl] phosphate (PubChem CID 157218973) has the molecular formula C32H30NaO8P and a molecular weight of 596.55 g/mol. Its IUPAC name is sodium bis[4-[3-(2-hydroxyphenyl)-3-oxopropyl]-3-methylphenyl] phosphate.
| Compound Name | sodium bis[4-[3-(2-hydroxyphenyl)-3-oxopropyl]-3-methylphenyl] phosphate |
|---|---|
| PubChem CID | 157218973 |
| Molecular Formula | C32H30NaO8P |
| Molecular Weight | 596.55 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | sodium bis[4-[3-(2-hydroxyphenyl)-3-oxopropyl]-3-methylphenyl] phosphate |
| SMILES | Cc1cc(OP(=O)([O-])Oc2ccc(CCC(=O)c3ccccc3O)c(C)c2)ccc1CCC(=O)c1ccccc1O.[Na+] |
| InChI | InChI=1S/C32H31O8P.Na/c1-21-19-25(15-11-23(21)13-17-31(35)27-7-3-5-9-29(27)33)39-41(37,38)40-26-16-12-24(22(2)20-26)14-18-32(36)28-8-4-6-10-30(28)34;/h3-12,15-16,19-20,33-34H,13-14,17-18H2,1-2H3,(H,37,38);/q;+1/p-1 |
| InChIKey | ASTIYINLUIRGIA-UHFFFAOYSA-M |
| XLogP | 3.28 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|