C17H20MnN2O4 — CID 67559134
2-hydroxy-N-[2-[(2-hydroxy-4-methoxyphenyl)methylamino]ethyl]benzamide;manganese (PubChem CID 67559134) has the molecular formula C17H20MnN2O4 and a molecular weight of 371.30 g/mol. Its IUPAC name is 2-hydroxy-N-[2-[(2-hydroxy-4-methoxyphenyl)methylamino]ethyl]benzamide;manganese.
| Compound Name | 2-hydroxy-N-[2-[(2-hydroxy-4-methoxyphenyl)methylamino]ethyl]benzamide;manganese |
|---|---|
| PubChem CID | 67559134 |
| Molecular Formula | C17H20MnN2O4 |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-hydroxy-N-[2-[(2-hydroxy-4-methoxyphenyl)methylamino]ethyl]benzamide;manganese |
| SMILES | COc1ccc(CNCCNC(=O)c2ccccc2O)c(O)c1.[Mn] |
| InChI | InChI=1S/C17H20N2O4.Mn/c1-23-13-7-6-12(16(21)10-13)11-18-8-9-19-17(22)14-4-2-3-5-15(14)20;/h2-7,10,18,20-21H,8-9,11H2,1H3,(H,19,22); |
| InChIKey | UITOZHJAWWAFJF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|